C13H17NO4 — CID 117011181
5-(2-hydroxyethyl)-3-(2-methoxyphenyl)-1,3-oxazinan-2-one (PubChem CID 117011181) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3-(2-methoxyphenyl)-1,3-oxazinan-2-one.
| Compound Name | 5-(2-hydroxyethyl)-3-(2-methoxyphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117011181 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5-(2-hydroxyethyl)-3-(2-methoxyphenyl)-1,3-oxazinan-2-one |
| SMILES | COc1ccccc1N1CC(CCO)COC1=O |
| InChI | InChI=1S/C13H17NO4/c1-17-12-5-3-2-4-11(12)14-8-10(6-7-15)9-18-13(14)16/h2-5,10,15H,6-9H2,1H3 |
| InChIKey | IIBMQRHELFEKJJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |