C10H19NO4 — CID 117011136
5-(2-hydroxyethyl)-3-(3-methoxypropyl)-1,3-oxazinan-2-one (PubChem CID 117011136) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3-(3-methoxypropyl)-1,3-oxazinan-2-one.
| Compound Name | 5-(2-hydroxyethyl)-3-(3-methoxypropyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117011136 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 5-(2-hydroxyethyl)-3-(3-methoxypropyl)-1,3-oxazinan-2-one |
| SMILES | COCCCN1CC(CCO)COC1=O |
| InChI | InChI=1S/C10H19NO4/c1-14-6-2-4-11-7-9(3-5-12)8-15-10(11)13/h9,12H,2-8H2,1H3 |
| InChIKey | XSPLDZDSXWGQQO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|