C15H12BrFO2 — CID 90784820
6-bromo-7-fluoro-2-hexa-1,3,5-trien-3-yl-2,3-dihydrochromen-4-one (PubChem CID 90784820) has the molecular formula C15H12BrFO2 and a molecular weight of 323.16 g/mol. Its IUPAC name is 6-bromo-7-fluoro-2-hexa-1,3,5-trien-3-yl-2,3-dihydrochromen-4-one.
| Compound Name | 6-bromo-7-fluoro-2-hexa-1,3,5-trien-3-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 90784820 |
| Molecular Formula | C15H12BrFO2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 6-bromo-7-fluoro-2-hexa-1,3,5-trien-3-yl-2,3-dihydrochromen-4-one |
| SMILES | C=CC=C(C=C)C1CC(=O)c2cc(Br)c(F)cc2O1 |
| InChI | InChI=1S/C15H12BrFO2/c1-3-5-9(4-2)14-8-13(18)10-6-11(16)12(17)7-15(10)19-14/h3-7,14H,1-2,8H2 |
| InChIKey | LKQDCKORDZMHDJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|