C15H29NO3 — CID 142071064
5,6-bis(ethenyl)-2,3-dihydro-1,4-dioxine-2-carboxamide;ethane (PubChem CID 142071064) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2,3-dihydro-1,4-dioxine-2-carboxamide;ethane.
| Compound Name | 5,6-bis(ethenyl)-2,3-dihydro-1,4-dioxine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142071064 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 5,6-bis(ethenyl)-2,3-dihydro-1,4-dioxine-2-carboxamide;ethane |
| SMILES | C=CC1=C(C=C)OC(C(N)=O)CO1.CC.CC.CC |
| InChI | InChI=1S/C9H11NO3.3C2H6/c1-3-6-7(4-2)13-8(5-12-6)9(10)11;3*1-2/h3-4,8H,1-2,5H2,(H2,10,11);3*1-2H3 |
| InChIKey | GQLFEKBHGJLXTR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |