C9H12O5 — CID 134599610
pent-4-enyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599610) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is pent-4-enyl 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | pent-4-enyl 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134599610 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | pent-4-enyl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C=CCCCOC(=O)C1COC(=O)O1 |
| InChI | InChI=1S/C9H12O5/c1-2-3-4-5-12-8(10)7-6-13-9(11)14-7/h2,7H,1,3-6H2 |
| InChIKey | ZBRXXGARWRLRKF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|