C12H14O10 — CID 134599718
3-(2-oxo-1,3-dioxolane-4-carbonyl)oxybutan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599718) has the molecular formula C12H14O10 and a molecular weight of 318.23 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dioxolane-4-carbonyl)oxybutan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | 3-(2-oxo-1,3-dioxolane-4-carbonyl)oxybutan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134599718 |
| Molecular Formula | C12H14O10 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-(2-oxo-1,3-dioxolane-4-carbonyl)oxybutan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | CC(OC(=O)C1COC(=O)O1)C(C)OC(=O)C1COC(=O)O1 |
| InChI | InChI=1S/C12H14O10/c1-5(19-9(13)7-3-17-11(15)21-7)6(2)20-10(14)8-4-18-12(16)22-8/h5-8H,3-4H2,1-2H3 |
| InChIKey | ZKALTNNCZRQBFK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|