C27H38O18 — CID 70640777
2-[2,3-bis[1-(2-oxo-1,3-dioxolane-4-carbonyl)oxypropan-2-yloxy]hexoxy]propyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 70640777) has the molecular formula C27H38O18 and a molecular weight of 650.58 g/mol. Its IUPAC name is 2-[2,3-bis[1-(2-oxo-1,3-dioxolane-4-carbonyl)oxypropan-2-yloxy]hexoxy]propyl 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | 2-[2,3-bis[1-(2-oxo-1,3-dioxolane-4-carbonyl)oxypropan-2-yloxy]hexoxy]propyl 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 70640777 |
| Molecular Formula | C27H38O18 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 2-[2,3-bis[1-(2-oxo-1,3-dioxolane-4-carbonyl)oxypropan-2-yloxy]hexoxy]propyl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | CCCC(OC(C)COC(=O)C1COC(=O)O1)C(COC(C)COC(=O)C1COC(=O)O1)OC(C)COC(=O)C1COC(=O)O1 |
| InChI | InChI=1S/C27H38O18/c1-5-6-17(41-15(3)8-36-23(29)20-12-39-26(32)44-20)18(42-16(4)9-37-24(30)21-13-40-27(33)45-21)10-34-14(2)7-35-22(28)19-11-38-25(31)43-19/h14-21H,5-13H2,1-4H3 |
| InChIKey | LAJWNIZRIJQSIH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|