C14H16O10 — CID 134599720
[4-(2-oxo-1,3-dioxolane-4-carbonyl)oxycyclohexyl] 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599720) has the molecular formula C14H16O10 and a molecular weight of 344.27 g/mol. Its IUPAC name is [4-(2-oxo-1,3-dioxolane-4-carbonyl)oxycyclohexyl] 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | [4-(2-oxo-1,3-dioxolane-4-carbonyl)oxycyclohexyl] 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134599720 |
| Molecular Formula | C14H16O10 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [4-(2-oxo-1,3-dioxolane-4-carbonyl)oxycyclohexyl] 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | O=C1OCC(C(=O)OC2CCC(OC(=O)C3COC(=O)O3)CC2)O1 |
| InChI | InChI=1S/C14H16O10/c15-11(9-5-19-13(17)23-9)21-7-1-2-8(4-3-7)22-12(16)10-6-20-14(18)24-10/h7-10H,1-6H2 |
| InChIKey | HFKSCUXGVLPNOW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|