C18H24O10 — CID 102303855
[4-(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxycyclohexyl] 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 102303855) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is [4-(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxycyclohexyl] 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
| Compound Name | [4-(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxycyclohexyl] 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 102303855 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [4-(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxycyclohexyl] 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C(=O)OC2CCC(OC(=O)C3(C)COC(=O)OC3)CC2)COC(=O)OC1 |
| InChI | InChI=1S/C18H24O10/c1-17(7-23-15(21)24-8-17)13(19)27-11-3-5-12(6-4-11)28-14(20)18(2)9-25-16(22)26-10-18/h11-12H,3-10H2,1-2H3 |
| InChIKey | OAWPQBYDICTAEQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|