C18H34O6 — CID 159790585
prop-2-en-1-ol;prop-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;bis(1-tritiopropane) (PubChem CID 159790585) has the molecular formula C18H34O6 and a molecular weight of 350.48 g/mol. Its IUPAC name is prop-2-en-1-ol;prop-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;bis(1-tritiopropane).
| Compound Name | prop-2-en-1-ol;prop-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;bis(1-tritiopropane) |
|---|---|
| PubChem CID | 159790585 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | prop-2-en-1-ol;prop-2-enyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;bis(1-tritiopropane) |
| SMILES | C=CCO.C=CCOC(=O)C1(C)COC(=O)OC1.[3H]CCC.[3H]CCC |
| InChI | InChI=1S/C9H12O5.C3H6O.2C3H8/c1-3-4-12-7(10)9(2)5-13-8(11)14-6-9;1-2-3-4;2*1-3-2/h3H,1,4-6H2,2H3;2,4H,1,3H2;2*3H2,1-2H3/i;;2*1T |
| InChIKey | NIMSFHFLJQELDI-MLMGVMGHSA-N |
| XLogP | 3.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|