C21H28Cl2O14 — CID 157169140
3-chloropropyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;5-methyl-2-oxo-1,3-dioxane-5-carbonyl chloride;5-methyl-2-oxo-1,3-dioxane-5-carboxylic acid (PubChem CID 157169140) has the molecular formula C21H28Cl2O14 and a molecular weight of 575.35 g/mol. Its IUPAC name is 3-chloropropyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;5-methyl-2-oxo-1,3-dioxane-5-carbonyl chloride;5-methyl-2-oxo-1,3-dioxane-5-carboxylic acid.
| Compound Name | 3-chloropropyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;5-methyl-2-oxo-1,3-dioxane-5-carbonyl chloride;5-methyl-2-oxo-1,3-dioxane-5-carboxylic acid |
|---|---|
| PubChem CID | 157169140 |
| Molecular Formula | C21H28Cl2O14 |
| Molecular Weight | 575.35 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 3-chloropropyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;5-methyl-2-oxo-1,3-dioxane-5-carbonyl chloride;5-methyl-2-oxo-1,3-dioxane-5-carboxylic acid |
| SMILES | CC1(C(=O)Cl)COC(=O)OC1.CC1(C(=O)O)COC(=O)OC1.CC1(C(=O)OCCCCl)COC(=O)OC1 |
| InChI | InChI=1S/C9H13ClO5.C6H7ClO4.C6H8O5/c1-9(5-14-8(12)15-6-9)7(11)13-4-2-3-10;2*1-6(4(7)8)2-10-5(9)11-3-6/h2-6H2,1H3;2-3H2,1H3;2-3H2,1H3,(H,7,8) |
| InChIKey | ANGGMKPXRJHQDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|