C11H18O7 — CID 59608821
2-(2-methoxyethoxy)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 59608821) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 59608821 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | COCCOCCOC(=O)C1(C)COC(=O)OC1 |
| InChI | InChI=1S/C11H18O7/c1-11(7-17-10(13)18-8-11)9(12)16-6-5-15-4-3-14-2/h3-8H2,1-2H3 |
| InChIKey | LJACSNHLPGNNSD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|