C30H30F10O14 — CID 162034944
2-methoxyethanol;(2,3,4,5,6-pentafluorophenyl) 2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoate;(2,3,4,5,6-pentafluorophenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 162034944) has the molecular formula C30H30F10O14 and a molecular weight of 804.54 g/mol. Its IUPAC name is 2-methoxyethanol;(2,3,4,5,6-pentafluorophenyl) 2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoate;(2,3,4,5,6-pentafluorophenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
| Compound Name | 2-methoxyethanol;(2,3,4,5,6-pentafluorophenyl) 2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoate;(2,3,4,5,6-pentafluorophenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 162034944 |
| Molecular Formula | C30H30F10O14 |
| Molecular Weight | 804.54 g/mol |
| Exact Mass | 804.15 |
| IUPAC Name | 2-methoxyethanol;(2,3,4,5,6-pentafluorophenyl) 2-(hydroxymethyl)-3-(2-methoxyethoxycarbonyloxy)-2-methylpropanoate;(2,3,4,5,6-pentafluorophenyl) 5-methyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)COC(=O)OC1.COCCO.COCCOC(=O)OCC(C)(CO)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H15F5O7.C12H7F5O5.C3H8O2/c1-15(5-21,6-26-14(23)25-4-3-24-2)13(22)27-12-10(19)8(17)7(16)9(18)11(12)20;1-12(2-20-11(19)21-3-12)10(18)22-9-7(16)5(14)4(13)6(15)8(9)17;1-5-3-2-4/h21H,3-6H2,1-2H3;2-3H2,1H3;4H,2-3H2,1H3 |
| InChIKey | YWNHSJPQDQIKHB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|