About 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate
2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 89434638) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
Analyze 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The IUPAC name of 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate (CID 89434638) is 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate.
What is the SMILES notation for 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The canonical SMILES for 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is CC1(C(=O)OCCN)COC(=O)OC1.
What is the InChIKey of 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
The InChIKey is MKYHVRJHMXCHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-8(6(10)12-3-2-9)4-13-7(11)14-5-8/h2-5,9H2,1H3.
What are the key properties of 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate?
2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate has a molecular weight of 203.19 g/mol, XLogP of -0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 89434638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).