C4H3IO5 — CID 155049716
iodo 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 155049716) has the molecular formula C4H3IO5 and a molecular weight of 257.97 g/mol. Its IUPAC name is iodo 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | iodo 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 155049716 |
| Molecular Formula | C4H3IO5 |
| Molecular Weight | 257.97 g/mol |
| Exact Mass | 257.90 |
| IUPAC Name | iodo 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | O=C1OCC(C(=O)OI)O1 |
| InChI | InChI=1S/C4H3IO5/c5-10-3(6)2-1-8-4(7)9-2/h2H,1H2 |
| InChIKey | GUQCXWNJAQKLQG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.97 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|