About CID 172774171
CID 172774171 (PubChem CID 172774171) has the molecular formula C3H3FLiO3
and a molecular weight of 112.99 g/mol.
Molecular Properties
| Compound Name | CID 172774171 |
| PubChem CID | 172774171 |
| Molecular Formula | C3H3FLiO3 |
| Molecular Weight | 112.99 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | — |
| SMILES | O=C1OCC(F)O1.[Li] |
| InChI | InChI=1S/C3H3FO3.Li/c4-2-1-6-3(5)7-2;/h2H,1H2; |
| InChIKey | NIYPUSDYSKCUCQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.99 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 172774171 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172774171?
The IUPAC name of CID 172774171 (CID 172774171) is not available.
What is the SMILES notation for CID 172774171?
The canonical SMILES for CID 172774171 is O=C1OCC(F)O1.[Li].
What is the InChIKey of CID 172774171?
The InChIKey is NIYPUSDYSKCUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3FO3.Li/c4-2-1-6-3(5)7-2;/h2H,1H2;.
What are the key properties of CID 172774171?
CID 172774171 has a molecular weight of 112.99 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172774171 is sourced from PubChem (CID 172774171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).