C5H7FO9S2 — CID 175563848
1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide;4-fluoro-1,3-dioxolan-2-one (PubChem CID 175563848) has the molecular formula C5H7FO9S2 and a molecular weight of 294.23 g/mol. Its IUPAC name is 1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide;4-fluoro-1,3-dioxolan-2-one.
| Compound Name | 1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide;4-fluoro-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 175563848 |
| Molecular Formula | C5H7FO9S2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide;4-fluoro-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(F)O1.O=S1(=O)CS(=O)(=O)OCO1 |
| InChI | InChI=1S/C3H3FO3.C2H4O6S2/c4-2-1-6-3(5)7-2;3-9(4)2-10(5,6)8-1-7-9/h2H,1H2;1-2H2 |
| InChIKey | BJBJJHSXULVWRF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|