C6H5F5O4 — CID 122599000
[1,1,2,2-tetrafluoro-3-(2-oxo-1,3-dioxolan-4-yl)propyl] hypofluorite (PubChem CID 122599000) has the molecular formula C6H5F5O4 and a molecular weight of 236.09 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-3-(2-oxo-1,3-dioxolan-4-yl)propyl] hypofluorite.
| Compound Name | [1,1,2,2-tetrafluoro-3-(2-oxo-1,3-dioxolan-4-yl)propyl] hypofluorite |
|---|---|
| PubChem CID | 122599000 |
| Molecular Formula | C6H5F5O4 |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | [1,1,2,2-tetrafluoro-3-(2-oxo-1,3-dioxolan-4-yl)propyl] hypofluorite |
| SMILES | O=C1OCC(CC(F)(F)C(F)(F)OF)O1 |
| InChI | InChI=1S/C6H5F5O4/c7-5(8,6(9,10)15-11)1-3-2-13-4(12)14-3/h3H,1-2H2 |
| InChIKey | UDIVUBOIKOFMDX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|