About 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one
4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one (PubChem CID 132504308) has the molecular formula C10H8F2O4
and a molecular weight of 230.17 g/mol. Its IUPAC name is 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one |
| PubChem CID | 132504308 |
| Molecular Formula | C10H8F2O4 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COc2cc(F)cc(F)c2)O1 |
| InChI | InChI=1S/C10H8F2O4/c11-6-1-7(12)3-8(2-6)14-4-9-5-15-10(13)16-9/h1-3,9H,4-5H2 |
| InChIKey | YHRZAHCZAZDKNN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one?
The IUPAC name of 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one (CID 132504308) is 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one.
What is the SMILES notation for 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one?
The canonical SMILES for 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one is O=C1OCC(COc2cc(F)cc(F)c2)O1.
What is the InChIKey of 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one?
The InChIKey is YHRZAHCZAZDKNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O4/c11-6-1-7(12)3-8(2-6)14-4-9-5-15-10(13)16-9/h1-3,9H,4-5H2.
What are the key properties of 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one?
4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one has a molecular weight of 230.17 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-difluorophenoxy)methyl]-1,3-dioxolan-2-one is sourced from PubChem (CID 132504308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).