C14H17ClO4 — CID 22154164
4-[(4-tert-butyl-3-chlorophenoxy)methyl]-1,3-dioxolan-2-one (PubChem CID 22154164) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-[(4-tert-butyl-3-chlorophenoxy)methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(4-tert-butyl-3-chlorophenoxy)methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 22154164 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-[(4-tert-butyl-3-chlorophenoxy)methyl]-1,3-dioxolan-2-one |
| SMILES | CC(C)(C)c1ccc(OCC2COC(=O)O2)cc1Cl |
| InChI | InChI=1S/C14H17ClO4/c1-14(2,3)11-5-4-9(6-12(11)15)17-7-10-8-18-13(16)19-10/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | QRYXHHGNIIFPNH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |