C12H14O5 — CID 171748740
4-[(2-ethoxyphenoxy)methyl]-1,3-dioxolan-2-one (PubChem CID 171748740) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-[(2-ethoxyphenoxy)methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(2-ethoxyphenoxy)methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 171748740 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-[(2-ethoxyphenoxy)methyl]-1,3-dioxolan-2-one |
| SMILES | CCOc1ccccc1OCC1COC(=O)O1 |
| InChI | InChI=1S/C12H14O5/c1-2-14-10-5-3-4-6-11(10)15-7-9-8-16-12(13)17-9/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | SNWYWFIUOYUNPH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |