C12H16N2O3 — CID 15337813
5-[(2-ethoxyphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 15337813) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-[(2-ethoxyphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 5-[(2-ethoxyphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 15337813 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-[(2-ethoxyphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCOc1ccccc1OCC1CN=C(N)O1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-15-10-5-3-4-6-11(10)16-8-9-7-14-12(13)17-9/h3-6,9H,2,7-8H2,1H3,(H2,13,14) |
| InChIKey | AXDKICDJQAVERN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |