About 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene
2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene (PubChem CID 143330300) has the molecular formula C17H17IO4
and a molecular weight of 412.22 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene |
| PubChem CID | 143330300 |
| Molecular Formula | C17H17IO4 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene |
| SMILES | CCOc1ccccc1I.O=CC1COc2ccccc2O1 |
| InChI | InChI=1S/C9H8O3.C8H9IO/c10-5-7-6-11-8-3-1-2-4-9(8)12-7;1-2-10-8-6-4-3-5-7(8)9/h1-5,7H,6H2;3-6H,2H2,1H3 |
| InChIKey | CJRZPEVRYXMQCN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene (CID 143330300) is 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene is CCOc1ccccc1I.O=CC1COc2ccccc2O1.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene?
The InChIKey is CJRZPEVRYXMQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.C8H9IO/c10-5-7-6-11-8-3-1-2-4-9(8)12-7;1-2-10-8-6-4-3-5-7(8)9/h1-5,7H,6H2;3-6H,2H2,1H3.
What are the key properties of 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene?
2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene has a molecular weight of 412.22 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine-3-carbaldehyde;1-ethoxy-2-iodobenzene is sourced from PubChem (CID 143330300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).