C11H9ClO5 — CID 132504313
(2-oxo-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate (PubChem CID 132504313) has the molecular formula C11H9ClO5 and a molecular weight of 256.64 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 132504313 |
| Molecular Formula | C11H9ClO5 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 4-chlorobenzoate |
| SMILES | O=C1OCC(COC(=O)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C11H9ClO5/c12-8-3-1-7(2-4-8)10(13)15-5-9-6-16-11(14)17-9/h1-4,9H,5-6H2 |
| InChIKey | XBLUXVDWLJCRLX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |