C21H22O13 — CID 145418968
bis[(2-oxo-1,3-dioxolan-4-yl)methyl] 5-(2-formyloxy-3-methoxypropyl)benzene-1,3-dicarboxylate (PubChem CID 145418968) has the molecular formula C21H22O13 and a molecular weight of 482.39 g/mol. Its IUPAC name is bis[(2-oxo-1,3-dioxolan-4-yl)methyl] 5-(2-formyloxy-3-methoxypropyl)benzene-1,3-dicarboxylate.
| Compound Name | bis[(2-oxo-1,3-dioxolan-4-yl)methyl] 5-(2-formyloxy-3-methoxypropyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 145418968 |
| Molecular Formula | C21H22O13 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | bis[(2-oxo-1,3-dioxolan-4-yl)methyl] 5-(2-formyloxy-3-methoxypropyl)benzene-1,3-dicarboxylate |
| SMILES | COCC(Cc1cc(C(=O)OCC2COC(=O)O2)cc(C(=O)OCC2COC(=O)O2)c1)OC=O |
| InChI | InChI=1S/C21H22O13/c1-27-6-15(32-11-22)4-12-2-13(18(23)28-7-16-9-30-20(25)33-16)5-14(3-12)19(24)29-8-17-10-31-21(26)34-17/h2-3,5,11,15-17H,4,6-10H2,1H3 |
| InChIKey | BMRBGVVKMOVUKF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|