C19H15ClO4 — CID 52942480
[5-(4-chlorophenyl)-6-oxo-2,3-dihydropyran-3-yl]methyl benzoate (PubChem CID 52942480) has the molecular formula C19H15ClO4 and a molecular weight of 342.78 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-6-oxo-2,3-dihydropyran-3-yl]methyl benzoate.
| Compound Name | [5-(4-chlorophenyl)-6-oxo-2,3-dihydropyran-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 52942480 |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [5-(4-chlorophenyl)-6-oxo-2,3-dihydropyran-3-yl]methyl benzoate |
| SMILES | O=C1OCC(COC(=O)c2ccccc2)C=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClO4/c20-16-8-6-14(7-9-16)17-10-13(12-24-19(17)22)11-23-18(21)15-4-2-1-3-5-15/h1-10,13H,11-12H2 |
| InChIKey | DVCQSVAAVKMPIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |