C21H22BrClO4 — CID 20507973
[2-(2-bromoethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 20507973) has the molecular formula C21H22BrClO4 and a molecular weight of 453.76 g/mol. Its IUPAC name is [2-(2-bromoethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [2-(2-bromoethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 20507973 |
| Molecular Formula | C21H22BrClO4 |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | [2-(2-bromoethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | O=C(OCC1COC(CCBr)(CCc2ccc(Cl)cc2)O1)c1ccccc1 |
| InChI | InChI=1S/C21H22BrClO4/c22-13-12-21(11-10-16-6-8-18(23)9-7-16)26-15-19(27-21)14-25-20(24)17-4-2-1-3-5-17/h1-9,19H,10-15H2 |
| InChIKey | KABVKPJMWHKPSB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|