C19H18BrClO5 — CID 58526666
[(2S,4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methoxybenzoate (PubChem CID 58526666) has the molecular formula C19H18BrClO5 and a molecular weight of 441.71 g/mol. Its IUPAC name is [(2S,4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methoxybenzoate.
| Compound Name | [(2S,4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 58526666 |
| Molecular Formula | C19H18BrClO5 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | [(2S,4S)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC[C@@H]2CO[C@@](CBr)(c3ccc(Cl)cc3)O2)cc1 |
| InChI | InChI=1S/C19H18BrClO5/c1-23-16-8-2-13(3-9-16)18(22)24-10-17-11-25-19(12-20,26-17)14-4-6-15(21)7-5-14/h2-9,17H,10-12H2,1H3/t17-,19-/m1/s1 |
| InChIKey | WOFAFQWHAPZRQD-IEBWSBKVSA-N |
| XLogP | 4.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|