C13H16BrClO6S — CID 88719732
[(2S,4S)-2-(bromomethyl)-2-(2-chloro-4-methoxyphenyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 88719732) has the molecular formula C13H16BrClO6S and a molecular weight of 415.69 g/mol. Its IUPAC name is [(2S,4S)-2-(bromomethyl)-2-(2-chloro-4-methoxyphenyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(2S,4S)-2-(bromomethyl)-2-(2-chloro-4-methoxyphenyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88719732 |
| Molecular Formula | C13H16BrClO6S |
| Molecular Weight | 415.69 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | [(2S,4S)-2-(bromomethyl)-2-(2-chloro-4-methoxyphenyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | COc1ccc([C@]2(CBr)OC[C@@H](COS(C)(=O)=O)O2)c(Cl)c1 |
| InChI | InChI=1S/C13H16BrClO6S/c1-18-9-3-4-11(12(15)5-9)13(8-14)19-6-10(21-13)7-20-22(2,16)17/h3-5,10H,6-8H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | KYHSPIFUURIMOD-GXFFZTMASA-N |
| XLogP | 2.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|