C14H15BrCl2O4 — CID 142667392
[2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl propanoate (PubChem CID 142667392) has the molecular formula C14H15BrCl2O4 and a molecular weight of 398.08 g/mol. Its IUPAC name is [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl propanoate.
| Compound Name | [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl propanoate |
|---|---|
| PubChem CID | 142667392 |
| Molecular Formula | C14H15BrCl2O4 |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1COC(CBr)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C14H15BrCl2O4/c1-2-13(18)19-6-10-7-20-14(8-15,21-10)11-4-3-9(16)5-12(11)17/h3-5,10H,2,6-8H2,1H3 |
| InChIKey | TYGCHYJFCWXGRN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|