C11H9BrCl2O4 — CID 11279723
(2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 11279723) has the molecular formula C11H9BrCl2O4 and a molecular weight of 356.00 g/mol. Its IUPAC name is (2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 11279723 |
| Molecular Formula | C11H9BrCl2O4 |
| Molecular Weight | 356.00 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | (2R,4R)-2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CO[C@](CBr)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C11H9BrCl2O4/c12-5-11(17-4-9(18-11)10(15)16)7-2-1-6(13)3-8(7)14/h1-3,9H,4-5H2,(H,15,16)/t9-,11+/m1/s1 |
| InChIKey | KPIZWXNSJSIGEY-KOLCDFICSA-N |
| XLogP | 3.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|