C18H17BrCl2O5S — CID 14053435
[2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 14053435) has the molecular formula C18H17BrCl2O5S and a molecular weight of 496.21 g/mol. Its IUPAC name is [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14053435 |
| Molecular Formula | C18H17BrCl2O5S |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 493.94 |
| IUPAC Name | [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COC(CBr)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C18H17BrCl2O5S/c1-12-2-5-15(6-3-12)27(22,23)25-10-14-9-24-18(11-19,26-14)16-7-4-13(20)8-17(16)21/h2-8,14H,9-11H2,1H3 |
| InChIKey | SDMYYFXUSGUINW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|