C27H26Cl2N3O8S2- — CID 22129649
[2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate;4-methylbenzenesulfonate (PubChem CID 22129649) has the molecular formula C27H26Cl2N3O8S2- and a molecular weight of 655.56 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate;4-methylbenzenesulfonate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22129649 |
| Molecular Formula | C27H26Cl2N3O8S2- |
| Molecular Weight | 655.56 g/mol |
| Exact Mass | 654.05 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COC(Cn3cncn3)(c3ccc(Cl)cc3Cl)O2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C20H19Cl2N3O5S.C7H8O3S/c1-14-2-5-17(6-3-14)31(26,27)29-10-16-9-28-20(30-16,11-25-13-23-12-24-25)18-7-4-15(21)8-19(18)22;1-6-2-4-7(5-3-6)11(8,9)10/h2-8,12-13,16H,9-11H2,1H3;2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | MCKPCMOBVKVYIJ-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 149.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|