C15H16Cl2N2O5S — CID 88665031
[2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 88665031) has the molecular formula C15H16Cl2N2O5S and a molecular weight of 407.28 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88665031 |
| Molecular Formula | C15H16Cl2N2O5S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1COC(Cc2ncc[nH]2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C15H16Cl2N2O5S/c1-25(20,21)23-9-11-8-22-15(24-11,7-14-18-4-5-19-14)12-3-2-10(16)6-13(12)17/h2-6,11H,7-9H2,1H3,(H,18,19) |
| InChIKey | MRLUIDQCOLDKPL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|