C21H20Cl2N4O3 — CID 70539497
N'-[2-[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]-4-methoxyphenyl]methanimidamide (PubChem CID 70539497) has the molecular formula C21H20Cl2N4O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is N'-[2-[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]-4-methoxyphenyl]methanimidamide.
| Compound Name | N'-[2-[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]-4-methoxyphenyl]methanimidamide |
|---|---|
| PubChem CID | 70539497 |
| Molecular Formula | C21H20Cl2N4O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N'-[2-[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]-4-methoxyphenyl]methanimidamide |
| SMILES | COc1ccc(/N=C\N)c([C@@H]2CO[C@](Cc3ncc[nH]3)(c3ccc(Cl)cc3Cl)O2)c1 |
| InChI | InChI=1S/C21H20Cl2N4O3/c1-28-14-3-5-18(27-12-24)15(9-14)19-11-29-21(30-19,10-20-25-6-7-26-20)16-4-2-13(22)8-17(16)23/h2-9,12,19H,10-11H2,1H3,(H2,24,27)(H,25,26)/t19-,21-/m0/s1 |
| InChIKey | CGXQUGTWRIGEPR-FPOVZHCZSA-N |
| XLogP | 4.53 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|