C33H33Cl2N7O4 — CID 70098454
4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazol-5-one (PubChem CID 70098454) has the molecular formula C33H33Cl2N7O4 and a molecular weight of 662.58 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 70098454 |
| Molecular Formula | C33H33Cl2N7O4 |
| Molecular Weight | 662.58 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cc1n[nH]c(=O)n1-c1ccc(N2CCN(c3ccc(OCC4COC(Cc5ncc[nH]5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H33Cl2N7O4/c1-22-38-39-32(43)42(22)26-5-3-24(4-6-26)40-14-16-41(17-15-40)25-7-9-27(10-8-25)44-20-28-21-45-33(46-28,19-31-36-12-13-37-31)29-11-2-23(34)18-30(29)35/h2-13,18,28H,14-17,19-21H2,1H3,(H,36,37)(H,39,43) |
| InChIKey | VWFQHCVSISBPGT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|