C35H34Cl2N6O6 — CID 54519717
1-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethylimidazolidine-2,4,5-trione (PubChem CID 54519717) has the molecular formula C35H34Cl2N6O6 and a molecular weight of 705.60 g/mol. Its IUPAC name is 1-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethylimidazolidine-2,4,5-trione.
| Compound Name | 1-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 54519717 |
| Molecular Formula | C35H34Cl2N6O6 |
| Molecular Weight | 705.60 g/mol |
| Exact Mass | 704.19 |
| IUPAC Name | 1-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-3-ethylimidazolidine-2,4,5-trione |
| SMILES | CCN1C(=O)C(=O)N(c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6ccnc6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)C1=O |
| InChI | InChI=1S/C35H34Cl2N6O6/c1-2-42-32(44)33(45)43(34(42)46)27-6-4-25(5-7-27)40-15-17-41(18-16-40)26-8-10-28(11-9-26)47-20-29-21-48-35(49-29,22-39-14-13-38-23-39)30-12-3-24(36)19-31(30)37/h3-14,19,23,29H,2,15-18,20-22H2,1H3/t29-,35-/m1/s1 |
| InChIKey | YOXNPJJHFWZJNB-BVGRYSDNSA-N |
| XLogP | 5.18 |
| TPSA | 109.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|