C37H38Cl2N6O6 — CID 54207655
1-butyl-3-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidine-2,4,5-trione (PubChem CID 54207655) has the molecular formula C37H38Cl2N6O6 and a molecular weight of 733.65 g/mol. Its IUPAC name is 1-butyl-3-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 54207655 |
| Molecular Formula | C37H38Cl2N6O6 |
| Molecular Weight | 733.65 g/mol |
| Exact Mass | 732.22 |
| IUPAC Name | 1-butyl-3-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6ccnc6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)C1=O |
| InChI | InChI=1S/C37H38Cl2N6O6/c1-2-3-15-44-34(46)35(47)45(36(44)48)29-7-5-27(6-8-29)42-17-19-43(20-18-42)28-9-11-30(12-10-28)49-22-31-23-50-37(51-31,24-41-16-14-40-25-41)32-13-4-26(38)21-33(32)39/h4-14,16,21,25,31H,2-3,15,17-20,22-24H2,1H3/t31-,37-/m1/s1 |
| InChIKey | PTRFCYWWBMIRFI-PRDAIKMNSA-N |
| XLogP | 5.96 |
| TPSA | 109.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|