C30H36Cl2N4O5 — CID 70486777
4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2,2-dimethylbutanoic acid (PubChem CID 70486777) has the molecular formula C30H36Cl2N4O5 and a molecular weight of 603.55 g/mol. Its IUPAC name is 4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 70486777 |
| Molecular Formula | C30H36Cl2N4O5 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCN1CCN(c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C30H36Cl2N4O5/c1-29(2,28(37)38)9-11-34-13-15-36(16-14-34)23-4-6-24(7-5-23)39-18-25-19-40-30(41-25,20-35-12-10-33-21-35)26-8-3-22(31)17-27(26)32/h3-8,10,12,17,21,25H,9,11,13-16,18-20H2,1-2H3,(H,37,38)/t25-,30-/m1/s1 |
| InChIKey | FOELZMIRLJTWNL-FYBSXPHGSA-N |
| XLogP | 5.16 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|