C31H40Cl2N6O4 — CID 70501600
1-butyl-3-[2-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethyl]urea (PubChem CID 70501600) has the molecular formula C31H40Cl2N6O4 and a molecular weight of 631.61 g/mol. Its IUPAC name is 1-butyl-3-[2-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethyl]urea.
| Compound Name | 1-butyl-3-[2-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 70501600 |
| Molecular Formula | C31H40Cl2N6O4 |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 1-butyl-3-[2-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethyl]urea |
| SMILES | CCCCNC(=O)NCCN1CCN(c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C31H40Cl2N6O4/c1-2-3-10-35-30(40)36-12-14-37-15-17-39(18-16-37)25-5-7-26(8-6-25)41-20-27-21-42-31(43-27,22-38-13-11-34-23-38)28-9-4-24(32)19-29(28)33/h4-9,11,13,19,23,27H,2-3,10,12,14-18,20-22H2,1H3,(H2,35,36,40)/t27-,31-/m1/s1 |
| InChIKey | SEWKZXSYUIUAEM-DLFZDVPBSA-N |
| XLogP | 4.76 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|