C23H21Cl2N5O3S — CID 54516402
4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 54516402) has the molecular formula C23H21Cl2N5O3S and a molecular weight of 518.43 g/mol. Its IUPAC name is 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 54516402 |
| Molecular Formula | C23H21Cl2N5O3S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1-c1ccc(OC[C@@H]2CO[C@@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C23H21Cl2N5O3S/c1-15-27-28-22(34)30(15)17-3-5-18(6-4-17)31-11-19-12-32-23(33-19,13-29-9-8-26-14-29)20-7-2-16(24)10-21(20)25/h2-10,14,19H,11-13H2,1H3,(H,28,34)/t19-,23-/m1/s1 |
| InChIKey | YMSKNKVLVZWGLT-AUSIDOKSSA-N |
| XLogP | 5.09 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|