C22H19Cl2N5O3S — CID 54311167
4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 54311167) has the molecular formula C22H19Cl2N5O3S and a molecular weight of 504.40 g/mol. Its IUPAC name is 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 54311167 |
| Molecular Formula | C22H19Cl2N5O3S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1-c1ccc(OC[C@@H]2CO[C@@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C22H19Cl2N5O3S/c23-15-1-6-19(20(24)9-15)22(12-28-8-7-25-13-28)31-11-18(32-22)10-30-17-4-2-16(3-5-17)29-14-26-27-21(29)33/h1-9,13-14,18H,10-12H2,(H,27,33)/t18-,22-/m1/s1 |
| InChIKey | SKZAZEGAWZLRJZ-XMSQKQJNSA-N |
| XLogP | 4.78 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|