C25H25Cl2N5O4 — CID 22808313
4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-2-propyl-1,2,4-triazol-3-one (PubChem CID 22808313) has the molecular formula C25H25Cl2N5O4 and a molecular weight of 530.41 g/mol. Its IUPAC name is 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-2-propyl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-2-propyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 22808313 |
| Molecular Formula | C25H25Cl2N5O4 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-2-propyl-1,2,4-triazol-3-one |
| SMILES | CCCn1ncn(-c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)c1=O |
| InChI | InChI=1S/C25H25Cl2N5O4/c1-2-10-32-24(33)31(17-29-32)19-4-6-20(7-5-19)34-13-21-14-35-25(36-21,15-30-11-9-28-16-30)22-8-3-18(26)12-23(22)27/h3-9,11-12,16-17,21H,2,10,13-15H2,1H3/t21-,25-/m1/s1 |
| InChIKey | MCFVLPHEKNDTOM-PXDATVDWSA-N |
| XLogP | 4.29 |
| TPSA | 85.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |