C40H45Cl2N7O6 — CID 14349981
4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-one (PubChem CID 14349981) has the molecular formula C40H45Cl2N7O6 and a molecular weight of 790.75 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 14349981 |
| Molecular Formula | C40H45Cl2N7O6 |
| Molecular Weight | 790.75 g/mol |
| Exact Mass | 789.28 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[3-(oxan-2-yloxy)propyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6ccnc6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)cnn1CCCOC1CCCCO1 |
| InChI | InChI=1S/C40H45Cl2N7O6/c41-30-5-14-36(37(42)24-30)40(27-45-17-15-43-28-45)54-26-35(55-40)25-53-34-12-10-32(11-13-34)47-20-18-46(19-21-47)31-6-8-33(9-7-31)48-29-44-49(39(48)50)16-3-23-52-38-4-1-2-22-51-38/h5-15,17,24,28-29,35,38H,1-4,16,18-23,25-27H2 |
| InChIKey | OYCPCCGESADYCK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 110.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|