C16H20Cl2N2O6S — CID 88719179
[2-(2,4-dichlorophenyl)-2-[(2-methylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid (PubChem CID 88719179) has the molecular formula C16H20Cl2N2O6S and a molecular weight of 439.32 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-[(2-methylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid.
| Compound Name | [2-(2,4-dichlorophenyl)-2-[(2-methylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid |
|---|---|
| PubChem CID | 88719179 |
| Molecular Formula | C16H20Cl2N2O6S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-[(2-methylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1nccn1CC1(c2ccc(Cl)cc2Cl)OCC(CO)O1 |
| InChI | InChI=1S/C15H16Cl2N2O3.CH4O3S/c1-10-18-4-5-19(10)9-15(21-8-12(7-20)22-15)13-3-2-11(16)6-14(13)17;1-5(2,3)4/h2-6,12,20H,7-9H2,1H3;1H3,(H,2,3,4) |
| InChIKey | GKURONDTMIPQJC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|