C15H16Cl2N2O5S — CID 88659366
1-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethanesulfonic acid (PubChem CID 88659366) has the molecular formula C15H16Cl2N2O5S and a molecular weight of 407.28 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethanesulfonic acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 88659366 |
| Molecular Formula | C15H16Cl2N2O5S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethanesulfonic acid |
| SMILES | CC(C1COC(Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1)S(=O)(=O)O |
| InChI | InChI=1S/C15H16Cl2N2O5S/c1-10(25(20,21)22)14-7-23-15(24-14,8-19-5-4-18-9-19)12-3-2-11(16)6-13(12)17/h2-6,9-10,14H,7-8H2,1H3,(H,20,21,22) |
| InChIKey | DKBJAPSGJJUBHB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|