C17H22Cl2N2O6S — CID 88718781
[2-(2,4-dichlorophenyl)-2-[(2-ethylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid (PubChem CID 88718781) has the molecular formula C17H22Cl2N2O6S and a molecular weight of 453.34 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-[(2-ethylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid.
| Compound Name | [2-(2,4-dichlorophenyl)-2-[(2-ethylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid |
|---|---|
| PubChem CID | 88718781 |
| Molecular Formula | C17H22Cl2N2O6S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-[(2-ethylimidazol-1-yl)methyl]-1,3-dioxolan-4-yl]methanol;methanesulfonic acid |
| SMILES | CCc1nccn1CC1(c2ccc(Cl)cc2Cl)OCC(CO)O1.CS(=O)(=O)O |
| InChI | InChI=1S/C16H18Cl2N2O3.CH4O3S/c1-2-15-19-5-6-20(15)10-16(22-9-12(8-21)23-16)13-4-3-11(17)7-14(13)18;1-5(2,3)4/h3-7,12,21H,2,8-10H2,1H3;1H3,(H,2,3,4) |
| InChIKey | JTYHQDKGCQRMHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|