C13H17ClO5S — CID 143933608
[(2R,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 143933608) has the molecular formula C13H17ClO5S and a molecular weight of 320.79 g/mol. Its IUPAC name is [(2R,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(2R,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 143933608 |
| Molecular Formula | C13H17ClO5S |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [(2R,4S)-2-(4-chlorophenyl)-2-ethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2)OC[C@@H](COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C13H17ClO5S/c1-3-13(10-4-6-11(14)7-5-10)17-8-12(19-13)9-18-20(2,15)16/h4-7,12H,3,8-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | GECHWDFBRBPCID-QWHCGFSZSA-N |
| XLogP | 2.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|