C16H17N3O5S — CID 88794252
[(2S,4S)-2-(4-cyanophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 88794252) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is [(2S,4S)-2-(4-cyanophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [(2S,4S)-2-(4-cyanophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88794252 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [(2S,4S)-2-(4-cyanophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1CO[C@@](Cn2ccnc2)(c2ccc(C#N)cc2)O1 |
| InChI | InChI=1S/C16H17N3O5S/c1-25(20,21)23-10-15-9-22-16(24-15,11-19-7-6-18-12-19)14-4-2-13(8-17)3-5-14/h2-7,12,15H,9-11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | CLIRNVFFNGBJRD-JKSUJKDBSA-N |
| XLogP | 1.00 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|