C18H24N2O5S — CID 20507872
[2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 20507872) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate.
| Compound Name | [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 20507872 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | Cc1ccc(CCC2(Cn3ccnc3)OCC(COS(C)(=O)=O)O2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-15-3-5-16(6-4-15)7-8-18(13-20-10-9-19-14-20)23-11-17(25-18)12-24-26(2,21)22/h3-6,9-10,14,17H,7-8,11-13H2,1-2H3 |
| InChIKey | JVFVPGNATTZBSS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|