About [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate
[2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate (PubChem CID 20507872) has the molecular formula C18H24N2O5S
and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate |
| PubChem CID | 20507872 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate |
| SMILES | Cc1ccc(CCC2(Cn3ccnc3)OCC(COS(C)(=O)=O)O2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-15-3-5-16(6-4-15)7-8-18(13-20-10-9-19-14-20)23-11-17(25-18)12-24-26(2,21)22/h3-6,9-10,14,17H,7-8,11-13H2,1-2H3 |
| InChIKey | JVFVPGNATTZBSS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate?
The IUPAC name of [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate (CID 20507872) is [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate.
What is the SMILES notation for [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate?
The canonical SMILES for [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate is Cc1ccc(CCC2(Cn3ccnc3)OCC(COS(C)(=O)=O)O2)cc1.
What is the InChIKey of [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate?
The InChIKey is JVFVPGNATTZBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O5S/c1-15-3-5-16(6-4-15)7-8-18(13-20-10-9-19-14-20)23-11-17(25-18)12-24-26(2,21)22/h3-6,9-10,14,17H,7-8,11-13H2,1-2H3.
What are the key properties of [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate?
[2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate has a molecular weight of 380.47 g/mol, XLogP of 1.91, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(imidazol-1-ylmethyl)-2-[2-(4-methylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl methanesulfonate is sourced from PubChem (CID 20507872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).